For research use only. Not for therapeutic Use.
2-Chloro-4-(methylthio)pyrimidine is a heterocyclic compound featuring a pyrimidine ring with a chlorine substituent at the 2-position and a methylthio group at the 4-position. This unique arrangement enhances its electronic properties, making it valuable in organic synthesis and medicinal chemistry. The chloro group can facilitate nucleophilic substitution reactions, while the methylthio group may influence lipophilicity and biological activity. This compound is potentially useful as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds in chemical research.
CAS Number | 49844-93-1 |
Molecular Formula | C5H5ClN2S |
Purity | ≥95% |
IUPAC Name | 2-chloro-4-methylsulfanylpyrimidine |
InChI | InChI=1S/C5H5ClN2S/c1-9-4-2-3-7-5(6)8-4/h2-3H,1H3 |
InChIKey | VAATWVRXPRDPPM-UHFFFAOYSA-N |
SMILES | CSC1=NC(=NC=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |