For research use only. Not for therapeutic Use.
2-Chloro-4-((piperidine-1-yl)methyl)pyridine (Cat No.:M097429) is a chemical compound belonging to the class of pyridine derivatives. It features a chlorine atom and a piperidinyl methyl group attached to the pyridine ring. Specific information about its properties and applications may be limited. Pyridine derivatives have diverse applications in medicinal chemistry and agrochemicals due to their varied properties and potential biological activities. However, further research is required to determine the specific uses and characteristics of 2-Chloro-4-((piperidine-1-yl)methyl)pyridine.
Catalog Number | M097429 |
CAS Number | 146270-01-1 |
Molecular Formula | C11H15ClN2 |
Purity | ≥95% |
Storage | Store at 2-8°C |
IUPAC Name | 2-chloro-4-(piperidin-1-ylmethyl)pyridine |
InChI | InChI=1S/C11H15ClN2/c12-11-8-10(4-5-13-11)9-14-6-2-1-3-7-14/h4-5,8H,1-3,6-7,9H2 |
InChIKey | FCGXHPOYGAGSIQ-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)CC2=CC(=NC=C2)Cl |