For research use only. Not for therapeutic Use.
2-Chloro-4-(trifluoromethyl)phenylboronic acid pinacol ester (Cat.No:L003578) is a pivotal chemical compound in organic synthesis. Its unique structure, incorporating a boronic acid motif, lends itself to various reactions, particularly Suzuki-Miyaura cross-coupling, enabling the construction of complex molecules. This compound is widely utilized in pharmaceutical and agrochemical research, highlighting its significance in the development of new therapeutic agents and crop protection chemicals.
CAS Number | 1165935-98-7 |
Molecular Formula | C13H15BClF3O2 |
Purity | ≥95% |
IUPAC Name | 2-[2-chloro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C13H15BClF3O2/c1-11(2)12(3,4)20-14(19-11)9-6-5-8(7-10(9)15)13(16,17)18/h5-7H,1-4H3 |
InChIKey | GASUPCHDYFQBAK-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |