For research use only. Not for therapeutic Use.
2-Chloro-5-chlorosulfonyl benzenesulfonamide is a sulfonamide derivative used in pharmaceutical research and organic synthesis. Its dual sulfonyl chloride groups and amine functionality make it a valuable intermediate for the development of sulfonamide-based drugs and other bioactive molecules. This compound is particularly useful in the synthesis of antibacterial agents, enzyme inhibitors, and other therapeutic compounds. Its reactivity allows for various chemical modifications, supporting advancements in medicinal chemistry and the design of novel pharmaceuticals.
CAS Number | 61450-06-4 |
Synonyms | 3-(Aminosulfonyl)-4-chloro-benzenesulfonyl Chloride; 2-Chloro-5-(chlorosulfonyl)benzene Sulfonamide; NSC 350626;? |
Molecular Formula | C6H5Cl2NO4S2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 4-chloro-3-sulfamoylbenzenesulfonyl chloride |
InChI | InChI=1S/C6H5Cl2NO4S2/c7-5-2-1-4(14(8,10)11)3-6(5)15(9,12)13/h1-3H,(H2,9,12,13) |
InChIKey | CADAUKUITLKLMI-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)S(=O)(=O)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |