For research use only. Not for therapeutic Use.
2-Chloro-5-fluoro-3-methylbenzaldehyde (Cat.No:L003501) is a crucial chemical compound with diverse applications. Its unique structure, featuring a chloro-fluoro-methyl substitution pattern, lends itself to various synthetic pathways. This aldehyde is utilized as a key intermediate in the preparation of specialized compounds for pharmaceutical and agrochemical industries.
CAS Number | 1807026-33-0 |
Molecular Formula | C8H6ClFO |
Purity | ≥95% |
IUPAC Name | 2-chloro-5-fluoro-3-methylbenzaldehyde |
InChI | InChI=1S/C8H6ClFO/c1-5-2-7(10)3-6(4-11)8(5)9/h2-4H,1H3 |
InChIKey | DTNSWRNZUMBLMA-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1Cl)C=O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |