For research use only. Not for therapeutic Use.
2-Chloro-5-fluoro-3-methylphenylboronic acid (Cat.No:L003835) is a crucial chemical compound in pharmaceutical research. Its unique structure, containing both boronic acid and halogen functionalities, makes it a versatile building block for the synthesis of specialized molecules. This compound is particularly valuable in the development of pharmaceutical agents and agrochemicals.
CAS Number | 2121511-44-0 |
Molecular Formula | C7H7BClFO2 |
Purity | ≥95% |
IUPAC Name | (2-chloro-5-fluoro-3-methylphenyl)boronic acid |
InChI | InChI=1S/C7H7BClFO2/c1-4-2-5(10)3-6(7(4)9)8(11)12/h2-3,11-12H,1H3 |
InChIKey | KHPUVWYDOOKESR-UHFFFAOYSA-N |
SMILES | B(C1=CC(=CC(=C1Cl)C)F)(O)O |