Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-Chloro-5-fluoro-4-methoxy-6-methylpyrimidine
For research use only. Not for therapeutic Use.
2-Chloro-5-fluoro-4-methoxy-6-methylpyrimidine is a heterocyclic compound featuring a pyrimidine ring with a chlorine atom at the 2-position, a fluorine atom at the 5-position, a methoxy group at the 4-position, and a methyl group at the 6-position. This unique arrangement of substituents enhances its reactivity and solubility, making it valuable in organic synthesis and medicinal chemistry. The compound may serve as an intermediate for developing pharmaceuticals or agrochemicals, with potential applications in targeting various biological pathways.
CAS Number | 1192479-35-8 |
Molecular Formula | C6H6ClFN2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-5-fluoro-4-methoxy-6-methylpyrimidine |
InChI | InChI=1S/C6H6ClFN2O/c1-3-4(8)5(11-2)10-6(7)9-3/h1-2H3 |
InChIKey | RWISDMQZKZXBIK-UHFFFAOYSA-N |
SMILES | CC1=C(C(=NC(=N1)Cl)OC)F |