For research use only. Not for therapeutic Use.
2-Chloro-5-hydroxybenzonitrile(Cat No.:L044153)is an aromatic compound used in organic synthesis and pharmaceutical research. The molecule features a benzene ring with a chlorine atom at the 2-position, a hydroxyl group at the 5-position, and a nitrile group at the 1-position. This structure offers unique reactivity, making it valuable as an intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals and fine chemicals. The hydroxyl and nitrile groups allow for diverse chemical modifications, making this compound essential for researchers focused on drug discovery, medicinal chemistry, and material science applications.
CAS Number | 188774-56-3 |
Molecular Formula | C7H4ClNO |
Purity | ≥95% |
IUPAC Name | 2-chloro-5-hydroxybenzonitrile |
InChI | InChI=1S/C7H4ClNO/c8-7-2-1-6(10)3-5(7)4-9/h1-3,10H |
InChIKey | KGPMBYRSXTTZLG-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1O)C#N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |