For research use only. Not for therapeutic Use.
2-Chloro-5-methyl-3-nitropyridine(Cat No.:M334614)is a chlorinated and nitro-substituted pyridine derivative, known for its versatile applications in chemical synthesis. This compound is particularly valuable in the pharmaceutical industry for constructing complex molecules, including those used in drugs targeting neurological disorders and inflammation. The nitro group enhances its electrophilic properties, making it an excellent candidate for nucleophilic substitution reactions, while the methyl group provides steric effects that can influence reaction pathways. Its ability to undergo various transformations makes 2-Chloro-5-methyl-3-nitropyridine a key intermediate in the synthesis of active pharmaceutical ingredients (APIs).
CAS Number | 23056-40-8 |
Molecular Formula | C6H5ClN2O2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-5-methyl-3-nitropyridine |
InChI | InChI=1S/C6H5ClN2O2/c1-4-2-5(9(10)11)6(7)8-3-4/h2-3H,1H3 |
InChIKey | LUAJUWOJEFFNFE-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(N=C1)Cl)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |