For research use only. Not for therapeutic Use.
2′-Chloro-5′-nitroacetophenone(Cat No.:L019459)is a specialized chemical compound widely utilized in pharmaceutical research and organic synthesis. This compound, characterized by a chloro and nitro group attached to the acetophenone core, serves as a crucial intermediate in the synthesis of various bioactive molecules, including pharmaceuticals and agrochemicals. Its unique structural properties make it valuable in the development of anti-inflammatory, antimicrobial, and anticancer agents. With its high purity and consistent quality, 2′-Chloro-5′-nitroacetophenone is an essential component in advanced chemical research and drug development projects.
CAS Number | 23082-50-0 |
Molecular Formula | C8H6ClNO3 |
Purity | ≥95% |
IUPAC Name | 1-(2-chloro-5-nitrophenyl)ethanone |
InChI | InChI=1S/C8H6ClNO3/c1-5(11)7-4-6(10(12)13)2-3-8(7)9/h2-4H,1H3 |
InChIKey | PNXVQYABDFYOFY-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |