For research use only. Not for therapeutic Use.
2-Chloro-6-(2,2,3,3-tetrafluoropropoxy)pyrazine(Cat No.:L007521), is a chemical compound characterized by a pyrazine ring with a chlorine atom at the 2nd position and a tetrafluoropropoxy group at the 6th position. This compound is significant in the field of organic synthesis and materials science. Its unique structure and reactivity make it valuable for the development of various organic compounds, including pharmaceuticals and agrochemicals.
Catalog Number | L007521 |
CAS Number | 1039858-65-5 |
Molecular Formula | C7H5ClF4N2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-(2,2,3,3-tetrafluoropropoxy)pyrazine |
InChI | InChI=1S/C7H5ClF4N2O/c8-4-1-13-2-5(14-4)15-3-7(11,12)6(9)10/h1-2,6H,3H2 |
InChIKey | FFSYCDLXLWQBFE-UHFFFAOYSA-N |
SMILES | C1=C(N=C(C=N1)Cl)OCC(C(F)F)(F)F |