Home
>
Chemical Reagents>Organometallic Reagents> 2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-YL)phenol
For research use only. Not for therapeutic Use.
2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (Cat.No:L003549) is a significant chemical compound in materials science and pharmaceutical research. Its unique structure, featuring a boron-containing dioxaborolane moiety, renders it a valuable building block for the synthesis of specialized materials and pharmaceutical agents.
CAS Number | 1605331-70-1 |
Molecular Formula | C12H16BClO3 |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
InChI | InChI=1S/C12H16BClO3/c1-11(2)12(3,4)17-13(16-11)8-6-5-7-9(14)10(8)15/h5-7,15H,1-4H3 |
InChIKey | LNMUHOGYPHHVBG-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)O |