For research use only. Not for therapeutic Use.
[2-Chloro-6-(dimethylamino)phenyl]methanol(Cat No.:L007394), is a chemical compound with the molecular formula C9H12ClNO. It consists of a benzene ring substituted with chlorine and a hydroxyl group at positions 2 and 6, respectively, and a dimethylamino group attached to the benzene ring. This compound is important in the field of organic chemistry and drug synthesis due to its versatile reactivity. Compounds with similar structures are often utilized in the development of pharmaceuticals, agrochemicals, and various other specialty chemicals, making them essential building blocks in organic synthesis processes.
CAS Number | 1152515-03-1 |
Molecular Formula | C9H12ClNO |
Purity | ≥95% |
IUPAC Name | [2-chloro-6-(dimethylamino)phenyl]methanol |
InChI | InChI=1S/C9H12ClNO/c1-11(2)9-5-3-4-8(10)7(9)6-12/h3-5,12H,6H2,1-2H3 |
InChIKey | IZDKHQHTQOJRRB-UHFFFAOYSA-N |
SMILES | CN(C)C1=C(C(=CC=C1)Cl)CO |