For research use only. Not for therapeutic Use.
2-Chloro-6-fluoro-3-hydroxyphenylboronic acid(CAT: L044026) is a high-purity boronic acid derivative featuring a chlorine atom at the 2-position, a fluorine atom at the 6-position, and a hydroxyl group at the 3-position on a phenyl ring. The boronic acid group makes this compound highly valuable for Suzuki-Miyaura cross-coupling reactions, enabling the synthesis of complex molecular frameworks, including bioactive compounds, pharmaceuticals, and functional materials. Its halogen substitutions allow for selective transformations and derivatization, while the hydroxyl group enhances chemical versatility. 2-Chloro-6-fluoro-3-hydroxyphenylboronic acid is an essential building block in medicinal chemistry, agrochemicals, and material science for precision-driven research and development.
CAS Number | 957121-07-2 |
Molecular Formula | C6H5BClFO3 |
Purity | ≥95% |
IUPAC Name | (2-chloro-6-fluoro-3-hydroxyphenyl)boronic acid |
InChI | InChI=1S/C6H5BClFO3/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2,10-12H |
InChIKey | MMQMWHTYNPPUMF-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC(=C1Cl)O)F)(O)O |