For research use only. Not for therapeutic Use.
2-Chloro-6-fluoro-3-nitropyridine(Cat No.:L038392)is a halogenated pyridine derivative with a chlorine atom at the 2-position, a fluorine atom at the 6-position, and a nitro group at the 3-position. This compound is commonly used in pharmaceutical and agrochemical research as a versatile building block for synthesizing bioactive molecules. Its unique combination of substituents enhances reactivity, making it valuable in the development of complex organic compounds, including drug candidates and agrochemicals. 2-Chloro-6-fluoro-3-nitropyridine is essential for researchers exploring innovative synthetic methodologies and medicinal chemistry.
CAS Number | 333998-12-2 |
Molecular Formula | C5H2ClFN2O2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-fluoro-3-nitropyridine |
InChI | InChI=1S/C5H2ClFN2O2/c6-5-3(9(10)11)1-2-4(7)8-5/h1-2H |
InChIKey | SBLKLWBROBWDAO-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |