For research use only. Not for therapeutic Use.
2′-Chloro-6′-fluoroacetophenone(Cat No.:L019575)is a specialized chemical compound used in pharmaceutical and organic synthesis. Featuring a chloro group at the 2′ position and a fluoro group at the 6′ position on an acetophenone core, this compound is a valuable intermediate in the creation of various bioactive molecules and complex chemical structures. Its unique reactivity allows for diverse chemical transformations, making it essential in medicinal chemistry for the development of new therapeutic agents. This compound supports innovative research in drug discovery and the exploration of novel chemical pathways.
CAS Number | 87327-69-3 |
Molecular Formula | C8H6ClFO |
Purity | ≥95% |
IUPAC Name | 1-(2-chloro-6-fluorophenyl)ethanone |
InChI | InChI=1S/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
InChIKey | DNVGZKIRMBCQEQ-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=CC=C1Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |