For research use only. Not for therapeutic Use.
2-Chloro-6-iodopyrazine(CAT: L049156) is a high-purity halogenated heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring both chlorine and iodine substituents on a pyrazine ring, this compound serves as a versatile building block for synthesizing complex organic molecules, bioactive compounds, and advanced materials. Its unique dual-halogen structure makes it particularly valuable in cross-coupling reactions and medicinal chemistry applications. With exceptional stability and reactivity, 2-Chloro-6-iodopyrazine offers reliable performance, ensuring precision and consistency in advanced synthetic and research endeavors.
CAS Number | 120531-35-3 |
Molecular Formula | C4H2ClIN2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-iodopyrazine |
InChI | InChI=1S/C4H2ClIN2/c5-3-1-7-2-4(6)8-3/h1-2H |
InChIKey | OVZLLWLBKKQGKP-UHFFFAOYSA-N |
SMILES | C1=C(N=C(C=N1)I)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |