For research use only. Not for therapeutic Use.
2-Chloro-6-methylbenzoyl chloride(Cat No.:L006746). It is a benzoyl chloride derivative where a chlorine atom is positioned at the 2-position and a methyl group is attached to the 6-position of the benzene ring. This compound is a versatile reagent widely used in organic synthesis. Its reactive nature allows it to participate in various chemical reactions, making it valuable in the creation of complex molecules. Researchers utilize it as a key intermediate in the development of pharmaceuticals, agrochemicals, and specialty chemicals, enabling the synthesis of diverse organic compounds.
CAS Number | 89894-44-0 |
Molecular Formula | C8H6Cl2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-methylbenzoyl chloride |
InChI | InChI=1S/C8H6Cl2O/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3 |
InChIKey | NPRWNQSMJBAKCL-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)Cl)C(=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |