For research use only. Not for therapeutic Use.
2-Chloro-6-methylquinoline(CAT: L016928) is a high-quality heterocyclic compound featuring a chloro group at the 2nd position and a methyl group at the 6th position of the quinoline structure. Known for its versatility, this compound serves as a crucial intermediate in the synthesis of pharmaceuticals, agrochemicals, and functional materials. Its unique structural attributes make it a valuable building block for the development of biologically active molecules, such as antimicrobial and anticancer agents. With excellent stability and reactivity, 2-Chloro-6-methylquinoline is a reliable choice for research and industrial applications, supporting innovation in medicinal chemistry and fine chemical production.
CAS Number | 4295-11-8 |
Molecular Formula | C10H8ClN |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-methylquinoline |
InChI | InChI=1S/C10H8ClN/c1-7-2-4-9-8(6-7)3-5-10(11)12-9/h2-6H,1H3 |
InChIKey | FHHZTIXPIXHMLC-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1)N=C(C=C2)Cl |