For research use only. Not for therapeutic Use.
2-Chloro-6-phenoxypyrazine(Cat No.:L027348)is a heterocyclic aromatic compound featuring a chlorine atom at the 2-position and a phenoxy group at the 6-position on a pyrazine ring. This compound is widely used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its unique structure allows for versatile chemical modifications, making it valuable in medicinal chemistry and the development of bioactive molecules. 2-Chloro-6-phenoxypyrazine is essential for research and development in drug discovery, offering high reactivity and stability for complex synthetic applications.
Catalog Number | L027348 |
CAS Number | 64383-29-5 |
Molecular Formula | C10H7ClN2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-phenoxypyrazine |
InChI | InChI=1S/C10H7ClN2O/c11-9-6-12-7-10(13-9)14-8-4-2-1-3-5-8/h1-7H |
InChIKey | BXNWVXLGFGUJOW-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)OC2=CN=CC(=N2)Cl |