For research use only. Not for therapeutic Use.
2-Chloro-6-(trifluoromethyl)benzoic acid(Cat No.:L038479)is a halogenated benzoic acid derivative known for its unique combination of chlorine and trifluoromethyl groups. This structure enhances its chemical reactivity and acid strength, making it highly useful in organic synthesis, especially in the creation of pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group increases the compound’s metabolic stability and lipophilicity, which are desirable properties in drug development for improving bioavailability and durability within biological systems. 2-Chloro-6-(trifluoromethyl)benzoic acid serves as a pivotal building block in synthesizing advanced materials and active pharmaceutical ingredients.
CAS Number | 2376-00-3 |
Molecular Formula | C8H4ClF3O2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-(trifluoromethyl)benzoic acid |
InChI | InChI=1S/C8H4ClF3O2/c9-5-3-1-2-4(8(10,11)12)6(5)7(13)14/h1-3H,(H,13,14) |
InChIKey | OHWGZCNPFKBCDJ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)C(F)(F)F |