For research use only. Not for therapeutic Use.
2-Chloro-6,7-dimethoxy-3-methylquinoline is a chloro-substituted quinoline derivative featuring methoxy groups at the 6- and 7-positions and a methyl group at the 3-position. This compound is widely utilized in pharmaceutical and chemical research as an intermediate for synthesizing bioactive molecules, particularly in antimalarial and anticancer studies. Its unique combination of functional groups allows for selective modifications, aiding in the development of complex therapeutic compounds. Known for stability and reactivity, it supports efficient synthetic pathways in medicinal chemistry applications.
CAS Number | 577967-81-8 |
Molecular Formula | C12H12ClNO2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-6,7-dimethoxy-3-methylquinoline |
InChI | InChI=1S/C12H12ClNO2/c1-7-4-8-5-10(15-2)11(16-3)6-9(8)14-12(7)13/h4-6H,1-3H3 |
InChIKey | GQKKWBQAXORHHB-UHFFFAOYSA-N |
SMILES | CC1=CC2=CC(=C(C=C2N=C1Cl)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |