For research use only. Not for therapeutic Use.
2-Chloro-8-methoxy-10H-phenothiazine (Cat. No: M080550) is a heterocyclic compound, which can be used as an organic intermediate and pharmaceutical intermediate for the preparation of the biochemical industry.
| Catalog Number | M080550 |
| CAS Number | 17800-09-8 |
| Synonyms | 2-Chloro-8-methoxy-10H-phenothiazine |
| Molecular Formula | C13H10ClNOS |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 2-chloro-8-methoxy-10H-phenothiazine |
| InChI | InChI=1S/C13H10ClNOS/c1-16-9-3-5-13-11(7-9)15-10-6-8(14)2-4-12(10)17-13/h2-7,15H,1H3 |
| InChIKey | UEBZOYQVDRPXAB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC3=C(N2)C=C(C=C3)Cl |
