For research use only. Not for therapeutic Use.
2-Chloro-N-[(1-phenyl cyclopropyl)methyl]acetamide(Cat No.:L007674), is a chemical compound characterized by an acetamide group attached to a cyclopropyl methyl group substituted with a phenyl group and a chlorine atom. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a valuable intermediate in the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals.
CAS Number | 1087792-01-5 |
Molecular Formula | C12H14ClNO |
Purity | ≥95% |
IUPAC Name | 2-chloro-N-[(1-phenylcyclopropyl)methyl]acetamide |
InChI | InChI=1S/C12H14ClNO/c13-8-11(15)14-9-12(6-7-12)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,14,15) |
InChIKey | MNQFKJOYCGFKKX-UHFFFAOYSA-N |
SMILES | C1CC1(CNC(=O)CCl)C2=CC=CC=C2 |