For research use only. Not for therapeutic Use.
2-Chloro-N-(2-hydroxyethyl)-N-phenylacetamide(Cat No.:L007409), is a chemical compound. It falls under the class of acetamides, which are organic compounds containing an acetamide moiety (CH3C(O)NH2). In this molecule, a chlorine atom is attached to the second carbon, and there are hydroxyethyl and phenyl groups attached to the nitrogen atom of the acetamide moiety. Chemical compounds like this can have various applications in pharmaceuticals, specifically as intermediates in the synthesis of other organic compounds and potentially in medicinal chemistry research.
CAS Number | 28025-61-8 |
Molecular Formula | C10H12ClNO2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-N-(2-hydroxyethyl)-N-phenylacetamide |
InChI | InChI=1S/C10H12ClNO2/c11-8-10(14)12(6-7-13)9-4-2-1-3-5-9/h1-5,13H,6-8H2 |
InChIKey | URKKKJPZOQINOF-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)N(CCO)C(=O)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |