Home
>
Chemical Reagents>Organic Building Blocks> 2-chloro-N-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide
For research use only. Not for therapeutic Use.
2-chloro-N-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide(Cat No.:L007619), is a chemical compound with a cyclopropyl group, a tetrahydronaphthalen-1-yl group, and an acetamide moiety, with a chlorine atom attached at the 2-position. This unique molecular structure is significant in medicinal chemistry and drug discovery. Researchers study its interactions with biological targets, exploring its potential as a therapeutic agent. Its specific arrangement allows for diverse chemical modifications, enabling the development of compounds for biological testing.
CAS Number | 1443981-63-2 |
Molecular Formula | C15H18ClNO |
Purity | ≥95% |
IUPAC Name | 2-chloro-N-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
InChI | InChI=1S/C15H18ClNO/c16-10-15(18)17(12-8-9-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,12,14H,3,5,7-10H2 |
InChIKey | GISQBULGVHDDHB-UHFFFAOYSA-N |
SMILES | C1CC(C2=CC=CC=C2C1)N(C3CC3)C(=O)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |