For research use only. Not for therapeutic Use.
2-Chloro-N-phenylpropanamide is an organic compound featuring a chlorinated propanamide backbone with a phenyl group attached to the nitrogen. It serves as a versatile intermediate in organic synthesis, especially in the development of pharmaceuticals and agrochemicals. The amide functionality allows for further modifications, while the chlorine atom provides a reactive site for nucleophilic substitution reactions. This compound is used in various chemical transformations, making it valuable in medicinal chemistry for creating novel compounds with potential biological activities.
CAS Number | 21262-52-2 |
Molecular Formula | C9H10ClNO |
Purity | ≥95% |
IUPAC Name | 2-chloro-N-phenylpropanamide |
InChI | InChI=1S/C9H10ClNO/c1-7(10)9(12)11-8-5-3-2-4-6-8/h2-7H,1H3,(H,11,12) |
InChIKey | BWWXKHHVIAJJFM-UHFFFAOYSA-N |
SMILES | CC(C(=O)NC1=CC=CC=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |