Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-chloro-N-(pyridin-3-ylmethyl)acetamide hydrochloride
For research use only. Not for therapeutic Use.
2-Chloro-N-(pyridin-3-ylmethyl)acetamide hydrochloride(Cat No.:L007257), is a chemical compound used in scientific research and pharmaceutical development. This compound, often in its salt form (hydrochloride), is employed as a reagent in chemical and biochemical studies. The presence of the chloro group and the pyridinylmethyl moiety provides unique reactivity, making it useful in the synthesis of complex organic molecules. Researchers utilize it in the design and development of potential therapeutic agents, contributing significantly to the advancement of medicinal chemistry and drug discovery processes.
CAS Number | 1263276-30-7 |
Molecular Formula | C8H10Cl2N2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-N-(pyridin-3-ylmethyl)acetamide;hydrochloride |
InChI | InChI=1S/C8H9ClN2O.ClH/c9-4-8(12)11-6-7-2-1-3-10-5-7;/h1-3,5H,4,6H2,(H,11,12);1H |
InChIKey | VPNDSFDKPGYASM-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)CNC(=O)CCl.Cl |