For research use only. Not for therapeutic Use.
2-Chloroacetophenone, also known as CN gas or mace, is a chemical compound used primarily for riot control and in chemical warfare. It’s a colorless solid with a pungent odor. As a lacrimator (tear gas), it causes intense eye and respiratory irritation, leading to temporary incapacitation. While effective in dispersing crowds, its use is controversial due to its potential for causing injury, particularly to those with respiratory issues or sensitivity. Proper handling and regulation are crucial to mitigate its risks in civilian and military applications.
| Catalog Number | R069054 |
| CAS Number | 532-27-4 |
| Synonyms | a-Chloroacetophenone |
| Molecular Formula | C8H7ClO |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-chloro-1-phenylethanone |
| InChI | InChI=1S/C8H7ClO/c9-6-8(10)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | IMACFCSSMIZSPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCl |
