For research use only. Not for therapeutic Use.
2-Chloroadenine(Cat No.:L012153)is a halogenated purine derivative used as an important intermediate in the synthesis of nucleoside analogs and other bioactive compounds. This compound features a chlorine atom at the 2-position of the adenine ring, providing a site for further chemical modifications. It is particularly valuable in medicinal chemistry for developing antiviral, anticancer, and antifungal agents. Its role in nucleoside chemistry makes it essential for creating modified nucleotides, contributing to research in genetics, molecular biology, and drug discovery efforts aimed at targeting nucleic acid-related pathways.
CAS Number | 31458-56-7 |
Molecular Formula | C5H4ClN5 |
Purity | ≥95% |
IUPAC Name | 2-chloro-7H-purin-6-amine |
InChI | InChI=1S/C5H4ClN5/c6-5-10-3(7)2-4(11-5)9-1-8-2/h1H,(H3,7,8,9,10,11) |
InChIKey | HBJGQJWNMZDFKL-UHFFFAOYSA-N |
SMILES | C1=NC2=NC(=NC(=C2N1)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |