For research use only. Not for therapeutic Use.
2-Chlorobenzene-1,3,5-triol (Cat.No:L003869) is a significant chemical compound with versatile applications in pharmaceutical and chemical research. Its distinct trisubstituted benzene structure imparts unique reactivity and properties. This compound serves as a valuable scaffold in the synthesis of specialized molecules with potential biological activity.
CAS Number | 84743-76-0 |
Molecular Formula | C6H5ClO3 |
Purity | ≥95% |
IUPAC Name | 2-chlorobenzene-1,3,5-triol |
InChI | InChI=1S/C6H5ClO3/c7-6-4(9)1-3(8)2-5(6)10/h1-2,8-10H |
InChIKey | XHGZCXPDKIEKNY-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1O)Cl)O)O |