For research use only. Not for therapeutic Use.
2-Chlorobenzhydrol(CAT: I020811) is a chemical compound also known as alpha-chlorobenzyl alcohol. It is a racemic mixture of enantiomers, meaning it contains equal amounts of both the (+)- and (-)-forms. 2-Chlorobenzhydrol is characterized by the presence of a chlorine atom attached to the benzyl group. It has various applications in organic synthesis and can serve as a building block or intermediate for the synthesis of other compounds. The specific pharmacological actions and target for drugs associated with 2-Chlorobenzhydrol may depend on its further functionalization or utilization in specific chemical reactions.
CAS Number | 6954-45-6 |
Synonyms | 2-Chlorobenzhydrol, (+/-)- |
Molecular Formula | C13H11ClO |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | Benzenemethanol, 2-chloro-alpha-phenyl- |
InChI | InChI=1S/C13H11ClO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9,13,15H |
InChIKey | JGDRELLAZGINQM-UHFFFAOYSA-N |
SMILES | OC(C1=CC=CC=C1)C2=CC=CC=C2Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |