For research use only. Not for therapeutic Use.
2-Chlorocyclohexanone(CAT: R018361) is a chlorinated cyclic ketone widely used as an intermediate in organic synthesis. This compound features a chlorine atom attached to the cyclohexanone ring, enhancing its reactivity and making it a valuable building block in the production of pharmaceuticals, agrochemicals, and fine chemicals. 2-Chlorocyclohexanone is often employed in the synthesis of more complex molecules through nucleophilic substitution, reduction, and other chemical transformations. Its structure allows for the introduction of chlorine into cyclohexane derivatives, which is essential in the development of biologically active compounds and materials with specialized properties. Additionally, it serves as a precursor in the synthesis of various heterocyclic compounds, which are important in medicinal chemistry and drug design.
CAS Number | 822-87-7 |
Synonyms | (±)-2-Chlorocyclohexanone; (±)-2-Chloro-1-cyclohexanone; 2-Chlorocyclohexan-1-one; NSC 12439; α-Chlorocyclohexanone |
Molecular Formula | C6H9ClO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chlorocyclohexan-1-one |
InChI | InChI=1S/C6H9ClO/c7-5-3-1-2-4-6(5)8/h5H,1-4H2 |
InChIKey | CCHNWURRBFGQCD-UHFFFAOYSA-N |
SMILES | C1CCC(=O)C(C1)Cl |