For research use only. Not for therapeutic Use.
2-Chloroethyl chloroformate (Cat.No:R062688) is a chemical compound used as a versatile reagent in organic synthesis. It’s commonly utilized for the introduction of the 2-chloroethyl carbamate protecting group, a crucial step in peptide and oligonucleotide chemistry. This compound plays a pivotal role in the development of various pharmaceutical and fine chemical products.
CAS Number | 627-11-2 |
Synonyms | β-Chloroethyl chloroformate; Chloroformic Acid 2-Chloroethyl Ester; (2-Chloroethoxy)carbonyl Chloride; 2-Chloroethyl Carbonochloridate; 2-Chloroethyl Chlorocarbonate; 2-Chloroethyl Chloroformate; Chloroethyl Chloroformate; Chloroformic Acid 2-Chloroe |
Molecular Formula | C3H4Cl2O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-chloroethyl carbonochloridate |
InChI | InChI=1S/C3H4Cl2O2/c4-1-2-7-3(5)6/h1-2H2 |
InChIKey | SVDDJQGVOFZBNX-UHFFFAOYSA-N |
SMILES | C(CCl)OC(=O)Cl |