For research use only. Not for therapeutic Use.
2-Chloroethyl laurate（Cat No.:L007007）, is an organic compound used in chemical synthesis and research. It belongs to the class of chloroethyl esters, which are valuable intermediates in various chemical transformations. This compound is often employed as a reagent in organic reactions, particularly in the creation of esters, amides, and other functional compounds. Researchers use 2-chloroethyl laurate to develop new materials, study reaction mechanisms, and design chemical processes.
| Catalog Number | L007007 |
| CAS Number | 64919-15-9 |
| Molecular Formula | C14H27ClO2 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | 2-chloroethyl dodecanoate |
| InChI | InChI=1S/C14H27ClO2/c1-2-3-4-5-6-7-8-9-10-11-14(16)17-13-12-15/h2-13H2,1H3 |
| InChIKey | PPRUSMUBWUQYRY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCC(=O)OCCCl |
