For research use only. Not for therapeutic Use.
2-Chloroethyl methacrylate (Cat No.:M123040) is a chemical. It is a clear, colorless liquid with a pungent odor. CEMA is primarily used in the production of polymers and copolymers for various applications, including adhesives, coatings, and medical devices. It is also used as a chemical intermediate in the synthesis of other compounds. CEMA is a reactive compound that undergoes polymerization readily, making it useful in polymer chemistry.
CAS Number | 1888-94-4 |
Molecular Formula | C6H9ClO2 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 2-chloroethyl 2-methylprop-2-enoate |
InChI | InChI=1S/C6H9ClO2/c1-5(2)6(8)9-4-3-7/h1,3-4H2,2H3 |
InChIKey | GPOGMJLHWQHEGF-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OCCCl |