For research use only. Not for therapeutic Use.
2-Chloroethyl myristate (Cat.No:L004150) is a significant chemical compound with diverse applications. Its unique structure, featuring a chloroethyl group and a myristate ester, imparts specialized reactivity. This compound serves as a valuable intermediate in the synthesis of specialized lipids and surfactants, with applications in various industries including cosmetics and pharmaceuticals.
CAS Number | 51479-36-8 |
Molecular Formula | C16H31ClO2 |
Purity | ≥95% |
IUPAC Name | 2-chloroethyl tetradecanoate |
InChI | InChI=1S/C16H31ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(18)19-15-14-17/h2-15H2,1H3 |
InChIKey | MPNMNLLETRXDEX-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCC(=O)OCCCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |