For research use only. Not for therapeutic Use.
2-Chloroinosine(Cat No.:R004216)is a modified nucleoside derived from inosine, characterized by the substitution of a chlorine atom at the 2-position of the purine ring. This compound is valuable in biochemical research, particularly in studies involving nucleic acid metabolism, enzymatic reactions, and RNA biology. 2-Chloroinosine is often used as a substrate or inhibitor in the investigation of enzyme functions, such as purine nucleoside phosphorylase. Its unique structure makes it a useful tool for exploring nucleotide analog interactions and developing potential therapeutic agents targeting viral and cancer-related pathways.
CAS Number | 13276-43-2 |
Synonyms | 2-CIDO |
Molecular Formula | C10H11ClN4O5 |
Purity | ≥95% |
Target | Nucleoside Antimetabolite/Analog |
Storage | -80°C |
IUPAC Name | 2-chloro-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
InChI | InChI=1S/C10H11ClN4O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H,13,14,19)/t3-,5-,6-,9-/m1/s1 |
InChIKey | NDSPCQCIHGSYAS-UUOKFMHZSA-N |
SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)NC(=NC2=O)Cl |