For research use only. Not for therapeutic Use.
2-(Chloromethyl)-3H-imidazo[4,5-b]pyridine hydrochloride(Cat No.:L007359), is a chemical compound with diverse applications in research and pharmaceutical fields. Its molecular structure includes an imidazopyridine ring system with a chloromethyl functional group. This compound is employed in medicinal chemistry for the development of new pharmaceuticals, serving as a valuable building block in drug discovery processes. Researchers use it to create derivatives and analogs, exploring their biological activities and potential therapeutic effects.
CAS Number | 24638-21-9 |
Molecular Formula | C7H7Cl2N3 |
Purity | ≥95% |
IUPAC Name | 2-(chloromethyl)-1H-imidazo[4,5-b]pyridine;hydrochloride |
InChI | InChI=1S/C7H6ClN3.ClH/c8-4-6-10-5-2-1-3-9-7(5)11-6;/h1-3H,4H2,(H,9,10,11);1H |
InChIKey | BZNLNCVIKIKSRZ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(N=C1)N=C(N2)CCl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |