For research use only. Not for therapeutic Use.
2-(Chloromethyl)-5-methoxypyridine is an organic compound with the molecular formula C₈H₉ClN. It features a pyridine ring with a chloromethyl group at the 2-position and a methoxy group at the 5-position. This compound appears as a colorless to light yellow liquid and is used as a building block in organic synthesis. Its unique functional groups make it valuable for developing pharmaceuticals and agrochemicals. Additionally, it may serve as an intermediate in the synthesis of various biologically active compounds, enhancing its significance in chemical research.
CAS Number | 75342-33-5 |
Molecular Formula | C7H8ClNO |
Purity | ≥95% |
IUPAC Name | 2-(chloromethyl)-5-methoxypyridine |
InChI | InChI=1S/C7H8ClNO/c1-10-7-3-2-6(4-8)9-5-7/h2-3,5H,4H2,1H3 |
InChIKey | KSBXDCBRSKRVDC-UHFFFAOYSA-N |
SMILES | COC1=CN=C(C=C1)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |