Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-(Chloromethyl)-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine
For research use only. Not for therapeutic Use.
2-(Chloromethyl)-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine(Cat No.:L007761), is a chemical compound. This compound features a furo[2,3-d]pyrimidine core, chloromethyl group, and phenyl substituents. Furo[2,3-d]pyrimidines have attracted interest in medicinal chemistry due to their potential biological activities. Researchers likely investigate this compound for its pharmacological properties, aiming for applications in drug discovery.
Catalog Number | L007761 |
CAS Number | 1000933-67-4 |
Molecular Formula | C19H14ClN3O |
Purity | ≥95% |
IUPAC Name | 2-(chloromethyl)-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine |
InChI | InChI=1S/C19H14ClN3O/c20-11-14-22-18(21)16-15(12-7-3-1-4-8-12)17(24-19(16)23-14)13-9-5-2-6-10-13/h1-10H,11H2,(H2,21,22,23) |
InChIKey | FMEVTKZWXSFLTQ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C(OC3=NC(=NC(=C23)N)CCl)C4=CC=CC=C4 |