For research use only. Not for therapeutic Use.
2-(Chloromethyl)-6-methylpyrazine hydrochloride(CAT: L033223) is a high-purity heterocyclic compound featuring a chloromethyl group and a methyl-substituted pyrazine ring, presented as its hydrochloride salt. This versatile molecule is widely used in pharmaceutical and chemical research as a key intermediate for synthesizing complex organic compounds, including bioactive molecules. Its unique structure and reactivity make it valuable for medicinal chemistry applications, facilitating the development of novel therapeutic agents. With reliable quality and excellent stability, 2-(Chloromethyl)-6-methylpyrazine hydrochloride supports advanced research in drug discovery and organic synthesis.
CAS Number | 1956319-38-2 |
Molecular Formula | C6H8Cl2N2 |
Purity | ≥95% |
IUPAC Name | 2-(chloromethyl)-6-methylpyrazine;hydrochloride |
InChI | InChI=1S/C6H7ClN2.ClH/c1-5-3-8-4-6(2-7)9-5;/h3-4H,2H2,1H3;1H |
InChIKey | MJHRDGFWYBXHLR-UHFFFAOYSA-N |
SMILES | CC1=CN=CC(=N1)CCl.Cl |