For research use only. Not for therapeutic Use.
2-Chloromethyl-8-methyl-imidazo[1,2-a]pyridine is a heterocyclic compound used as an intermediate in pharmaceutical and chemical research. Its imidazo[1,2-a]pyridine structure, with chloromethyl and methyl groups, offers unique reactivity, making it useful in the synthesis of bioactive molecules, including kinase inhibitors and other therapeutic agents. This compound is particularly valuable in medicinal chemistry for developing drugs targeting various biological pathways. Its versatility in chemical modifications supports advancements in drug discovery and molecular design.
CAS Number | 182181-42-6 |
Molecular Formula | C9H9ClN2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-(chloromethyl)-8-methylimidazo[1,2-a]pyridine |
InChI | InChI=1S/C9H9ClN2/c1-7-3-2-4-12-6-8(5-10)11-9(7)12/h2-4,6H,5H2,1H3 |
InChIKey | JMNFYFVRZBKRMY-UHFFFAOYSA-N |
SMILES | CC1=CC=CN2C1=NC(=C2)CCl |