For research use only. Not for therapeutic Use.
2-(Chloromethyl)benzoyl chloride(Cat No.:L006968), is a chemical compound represented as C8H6Cl2O2. It is a colorless to pale yellow liquid with a pungent odor. This compound is used as a versatile acylating agent in organic synthesis. Its chloromethyl and acyl chloride functional groups make it valuable for introducing benzoyl and chloromethyl functionalities into various organic compounds. 2-(Chloromethyl)benzoyl chloride is employed in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its reactivity allows for the creation of complex organic structures, making it essential in the development of novel materials and drugs in research, industrial, and pharmaceutical applications.
CAS Number | 42908-86-1 |
Molecular Formula | C8H6Cl2O |
Purity | ≥95% |
IUPAC Name | 2-(chloromethyl)benzoyl chloride |
InChI | InChI=1S/C8H6Cl2O/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2 |
InChIKey | TXZFBHYDQGYOIT-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CCl)C(=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |