For research use only. Not for therapeutic Use.
2-Chloronicotinaldehyde is a valuable chemical intermediate used in the synthesis of various pharmaceutical compounds. This chlorinated derivative of nicotinaldehyde features a reactive aldehyde group that makes it essential for constructing heterocyclic frameworks and complex organic molecules. Its versatility allows for applications in the development of new drugs, agrochemicals, and materials science. With its role in facilitating key reactions, 2-Chloronicotinaldehyde is widely employed in research focused on medicinal chemistry and organic synthesis. Its high purity and reactivity make it suitable for a variety of advanced chemical processes, ensuring consistent and reliable results.
CAS Number | 36404-88-3 |
Synonyms | 2-Chloro-3-formylpyridine; 2-Chloro-3-pyridinecarboxaldehyde; |
Molecular Formula | C6H4ClNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chloropyridine-3-carbaldehyde |
InChI | InChI=1S/C6H4ClNO/c7-6-5(4-9)2-1-3-8-6/h1-4H |
InChIKey | KHPAGGHFIDLUMB-UHFFFAOYSA-N |
SMILES | C1=CC(=C(N=C1)Cl)C=O |