For research use only. Not for therapeutic Use.
2-Chlorooxazole-5-carboxylic acid(Cat No.:L038975)is a specialized chemical compound utilized in pharmaceutical and organic synthesis. Featuring a chloro-substituted oxazole ring with a carboxylic acid group, this compound serves as a valuable intermediate in the creation of complex molecules, including potential drug candidates and bioactive substances. Its structure allows for diverse chemical modifications, making it crucial in medicinal chemistry for developing new therapeutic agents. This compound is particularly important in research focused on exploring novel heterocyclic frameworks and enhancing the efficacy of pharmaceutical compounds.
CAS Number | 1555623-55-6 |
Molecular Formula | C4H2ClNO3 |
Purity | ≥95% |
IUPAC Name | 2-chloro-1,3-oxazole-5-carboxylic acid |
InChI | InChI=1S/C4H2ClNO3/c5-4-6-1-2(9-4)3(7)8/h1H,(H,7,8) |
InChIKey | YPVRRKXUYHUYGA-UHFFFAOYSA-N |
SMILES | C1=C(OC(=N1)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |