For research use only. Not for therapeutic Use.
2-Chlorophenyl Cyclopentyl Ketone(CAT: R057367) serves multifaceted roles across different domains. In pharmaceuticals, it acts as a building block in the synthesis of various pharmacologically active compounds, contributing to drug development. Its chemical structure enables it to participate in organic transformations, making it valuable in synthetic organic chemistry. Additionally, this compound finds applications in material chemistry as a precursor for producing functionalized polymers with tailored properties for coatings and adhesives.
CAS Number | 6740-85-8 |
Synonyms | (2-Chlorobenzoyl)cyclopentane; Cyclopentyl 2-Chlorophenyl Ketone; Cyclopentyl o-Chlorophenyl Ketone; (2-Chlorophenyl)cyclopentylmethanone; |
Molecular Formula | C12H13ClO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2-chlorophenyl)-cyclopentylmethanone |
InChI | InChI=1S/C12H13ClO/c13-11-8-4-3-7-10(11)12(14)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2 |
InChIKey | QIJMMRNZBJHXRI-UHFFFAOYSA-N |
SMILES | C1CCC(C1)C(=O)C2=CC=CC=C2Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |