For research use only. Not for therapeutic Use.
2-Chloropropylbenzene(Cat No.:M051888) is an organic chemical compound with the formula C9H11Cl. This compound features a benzene ring bonded to a chloropropyl group, where the chlorine atom is attached to the second carbon of the propyl chain. It is a colorless liquid that is used primarily as an intermediate in the synthesis of other chemicals. The presence of the chloropropyl group makes it a useful precursor in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Its applications are particularly significant in the development of compounds requiring specific molecular architectures.
CAS Number | 10304-81-1 |
Molecular Formula | C9H11Cl |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-chloropropylbenzene |
InChI | InChI=1S/C9H11Cl/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
InChIKey | CKWAHIDVXZGPES-UHFFFAOYSA-N |
SMILES | CC(CC1=CC=CC=C1)Cl |