For research use only. Not for therapeutic Use.
2-Chloropurine(Cat No.:M123535)is a crucial heterocyclic compound widely used in pharmaceutical and biochemical research. As a derivative of purine, it features a chlorine atom at the 2-position, making it a versatile intermediate in the synthesis of nucleoside analogs and other bioactive molecules. Its unique structure allows for targeted modifications, enabling the development of antiviral, anticancer, and other therapeutic agents. 2-Chloropurine plays a significant role in medicinal chemistry, supporting high-precision synthesis and the advancement of innovative drug discovery and research efforts.
CAS Number | 1681-15-8 |
Molecular Formula | C5H3ClN4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chloro-7H-purine |
InChI | InChI=1S/C5H3ClN4/c6-5-7-1-3-4(10-5)9-2-8-3/h1-2H,(H,7,8,9,10) |
InChIKey | JBMBVWROWJGFMG-UHFFFAOYSA-N |
SMILES | C1=C2C(=NC(=N1)Cl)N=CN2 |