For research use only. Not for therapeutic Use.
2-Chloroquinazolin-8-ol(Cat No.:L018108)is a heterocyclic compound used in pharmaceutical research and organic synthesis. This molecule features a quinazoline ring with a chlorine atom at the 2-position and a hydroxyl group at the 8-position, making it a versatile intermediate in the development of bioactive molecules. It is commonly employed in the synthesis of potential therapeutic agents, particularly those targeting cancer, inflammation, or infectious diseases. The combination of the chloro and hydroxyl functionalities allows for diverse chemical reactions, supporting advanced research in medicinal chemistry and drug development.
CAS Number | 953039-10-6 |
Molecular Formula | C8H5ClN2O |
Purity | ≥95% |
IUPAC Name | 2-chloroquinazolin-8-ol |
InChI | InChI=1S/C8H5ClN2O/c9-8-10-4-5-2-1-3-6(12)7(5)11-8/h1-4,12H |
InChIKey | NFLGXMBUPVURGA-UHFFFAOYSA-N |
SMILES | C1=CC2=CN=C(N=C2C(=C1)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |